CAS 916177-00-9 appears in our catalog under these names: (5–(Methoxycarbonyl)–1–tosyl–1H–pyrrol–3–yl)boronic acid, (5-(Methoxycarbonyl)-1-tosyl-1H-pyrrol-3-yl)boronic acid, 97%, 97%, (5-(Methoxycarbonyl)-1-tosyl-1H-pyrrol-3-yl)boronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
[5-methoxycarbonyl-1-(4-methylphenyl)sulfonylpyrrol-3-yl]boronic acid (CAS 916177-00-9) is a chemical compound with the molecular formula C13H14BNO6S and a molecular weight of 323.1 g/mol. IUPAC name: [5-methoxycarbonyl-1-(4-methylphenyl)sulfonylpyrrol-3-yl]boronic acid. InChIKey: RCUJDNBFRQOHOY-UHFFFAOYSA-N.
| Molecular formula | C13H14BNO6S |
|---|---|
| Molecular weight | 323.1 g/mol |
| IUPAC name | [5-methoxycarbonyl-1-(4-methylphenyl)sulfonylpyrrol-3-yl]boronic acid |
| InChIKey | RCUJDNBFRQOHOY-UHFFFAOYSA-N |
| SMILES | B(C1=CN(C(=C1)C(=O)OC)S(=O)(=O)C2=CC=C(C=C2)C)(O)O |
Computed by PubChem (NCBI)