CAS 916211-62-6 is the registry number for (2,1,3-Benzothiadiazol-5-ylmethyl)amine trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.
2,1,3-benzothiadiazol-5-ylmethanamine;2,2,2-trifluoroacetic acid (CAS 916211-62-6) is a chemical compound with the molecular formula C9H8F3N3O2S and a molecular weight of 279.24 g/mol. IUPAC name: 2,1,3-benzothiadiazol-5-ylmethanamine;2,2,2-trifluoroacetic acid. InChIKey: JDWGVRHGTXKYJH-UHFFFAOYSA-N.
| Molecular formula | C9H8F3N3O2S |
|---|---|
| Molecular weight | 279.24 g/mol |
| IUPAC name | 2,1,3-benzothiadiazol-5-ylmethanamine;2,2,2-trifluoroacetic acid |
| InChIKey | JDWGVRHGTXKYJH-UHFFFAOYSA-N |
| SMILES | C1=CC2=NSN=C2C=C1CN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)