Products 916211-62-6

CAS 916211-62-6 is the registry number for (2,1,3-Benzothiadiazol-5-ylmethyl)amine trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2,1,3-benzothiadiazol-5-ylmethanamine;2,2,2-trifluoroacetic acid (CAS 916211-62-6) is a chemical compound with the molecular formula C9H8F3N3O2S and a molecular weight of 279.24 g/mol. IUPAC name: 2,1,3-benzothiadiazol-5-ylmethanamine;2,2,2-trifluoroacetic acid. InChIKey: JDWGVRHGTXKYJH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8F3N3O2S
Molecular weight279.24 g/mol
IUPAC name2,1,3-benzothiadiazol-5-ylmethanamine;2,2,2-trifluoroacetic acid
InChIKeyJDWGVRHGTXKYJH-UHFFFAOYSA-N
SMILESC1=CC2=NSN=C2C=C1CN.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)