CAS 916214-57-8 appears in our catalog under these names: Nelonemdaz potassium, 98%, Salfaprodil, Nelonemdaz potassium, Nelonemdaz (potassium), 99.86%, 99.86%, Nelonemdaz (potassium), 99.86%. Offered by: AmBeed, GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 10mM (in 1ml dmso), 5mg, 50mg, 1mg, 25 mg, 10mM/1mL.
Potassium 2-hydroxy-5-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]methylamino]benzoate (CAS 916214-57-8) is a chemical compound with the molecular formula C15H7F7KNO3 and a molecular weight of 421.31 g/mol. IUPAC name: potassium 2-hydroxy-5-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]methylamino]benzoate. InChIKey: KLOANMLPWLPVSW-UHFFFAOYSA-M.
| Molecular formula | C15H7F7KNO3 |
|---|---|
| Molecular weight | 421.31 g/mol |
| IUPAC name | potassium 2-hydroxy-5-[[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]methylamino]benzoate |
| InChIKey | KLOANMLPWLPVSW-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1NCC2=C(C(=C(C(=C2F)F)C(F)(F)F)F)F)C(=O)[O-])O.[K+] |
Computed by PubChem (NCBI)