Products 91668-84-7
CAS 91668-84-7 is the registry number for 2-Bromo-6-Methylpyridine 1-Oxide, 94%. Offered by: Chemat. Available pack sizes: 100mg, 1g.
2-bromo-6-methyl-1-oxidopyridin-1-ium (CAS 91668-84-7) is a chemical compound with the molecular formula C6H6BrNO and a molecular weight of 188.02 g/mol. IUPAC name: 2-bromo-6-methyl-1-oxidopyridin-1-ium. InChIKey: LZOXAGOIFMCDHY-UHFFFAOYSA-N.
| Molecular formula | C6H6BrNO |
|---|---|
| Molecular weight | 188.02 g/mol |
| IUPAC name | 2-bromo-6-methyl-1-oxidopyridin-1-ium |
| InChIKey | LZOXAGOIFMCDHY-UHFFFAOYSA-N |
| SMILES | CC1=[N+](C(=CC=C1)Br)[O-] |
Computed by PubChem (NCBI)