CAS 916734-43-5 appears in our catalog under these names: TC-I 15, 98%, TC-I 15, TC–I 15, TC-I 15, 99%, 99%, TC-I 15, 99.94%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 10mg, 50mg, 25mg, 5mg, 100 mg, 10mM/1mL, 50 mg.
(2S)-2-[[(4R)-3-(benzenesulfonyl)-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-3-(benzylcarbamoylamino)propanoic acid (CAS 916734-43-5) is a chemical compound with the molecular formula C23H28N4O6S2 and a molecular weight of 520.6 g/mol. IUPAC name: (2S)-2-[[(4R)-3-(benzenesulfonyl)-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-3-(benzylcarbamoylamino)propanoic acid. InChIKey: XKLHCUGVLCGKKX-RBUKOAKNSA-N.
| Molecular formula | C23H28N4O6S2 |
|---|---|
| Molecular weight | 520.6 g/mol |
| IUPAC name | (2S)-2-[[(4R)-3-(benzenesulfonyl)-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-3-(benzylcarbamoylamino)propanoic acid |
| InChIKey | XKLHCUGVLCGKKX-RBUKOAKNSA-N |
| SMILES | CC1([C@H](N(CS1)S(=O)(=O)C2=CC=CC=C2)C(=O)N[C@@H](CNC(=O)NCC3=CC=CC=C3)C(=O)O)C |
Computed by PubChem (NCBI)