CAS 916742-11-5 appears in our catalog under these names: JAK-IN-11, JAK-IN-11, 98.62%, Propanamide, JAK-IN-11/ 99.57% (existing batch purity). Offered by: TRC, Chemat, MedChemExpress, GLPBio, TargetMol. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 1mg, 10 mg, 1 mg.
N-[5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-2-methylphenyl]sulfonylpropanamide (CAS 916742-11-5) is a chemical compound with the molecular formula C23H22FN5O4S and a molecular weight of 483.5 g/mol. IUPAC name: N-[5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-2-methylphenyl]sulfonylpropanamide. InChIKey: IGLNXKVGKIFNBQ-UHFFFAOYSA-N.
| Molecular formula | C23H22FN5O4S |
|---|---|
| Molecular weight | 483.5 g/mol |
| IUPAC name | N-[5-[[5-fluoro-4-(4-prop-2-ynoxyanilino)pyrimidin-2-yl]amino]-2-methylphenyl]sulfonylpropanamide |
| InChIKey | IGLNXKVGKIFNBQ-UHFFFAOYSA-N |
| SMILES | CCC(=O)NS(=O)(=O)C1=C(C=CC(=C1)NC2=NC=C(C(=N2)NC3=CC=C(C=C3)OCC#C)F)C |
Computed by PubChem (NCBI)