CAS 91680-55-6 is the registry number for 4-((Thiophen-2-yl)methyl)phenol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(thiophen-2-ylmethyl)phenol (CAS 91680-55-6) is a chemical compound with the molecular formula C11H10OS and a molecular weight of 190.26 g/mol. IUPAC name: 4-(thiophen-2-ylmethyl)phenol. InChIKey: YHOIZMRUUWRATR-UHFFFAOYSA-N.
| Molecular formula | C11H10OS |
|---|---|
| Molecular weight | 190.26 g/mol |
| IUPAC name | 4-(thiophen-2-ylmethyl)phenol |
| InChIKey | YHOIZMRUUWRATR-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)CC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)