CAS 916979-09-4 is the registry number for 2–Amino–4–methylpyridine–d6. Offered by: GLPBio. Available pack sizes: 100mg.
3,5,6-trideuterio-4-(trideuteriomethyl)pyridin-2-amine (CAS 916979-09-4) is a chemical compound with the molecular formula C6H8N2 and a molecular weight of 114.18 g/mol. IUPAC name: 3,5,6-trideuterio-4-(trideuteriomethyl)pyridin-2-amine. InChIKey: ORLGLBZRQYOWNA-RLTMCGQMSA-N.
| Molecular formula | C6H8N2 |
|---|---|
| Molecular weight | 114.18 g/mol |
| IUPAC name | 3,5,6-trideuterio-4-(trideuteriomethyl)pyridin-2-amine |
| InChIKey | ORLGLBZRQYOWNA-RLTMCGQMSA-N |
| SMILES | [2H]C1=C(N=C(C(=C1C([2H])([2H])[2H])[2H])N)[2H] |
Computed by PubChem (NCBI)