CAS 916979-10-7 is the registry number for 2-Amino-5-methylpyridine-d6. Offered by: TRC. Available pack sizes: 50mg.
3,4,6-trideuterio-5-(trideuteriomethyl)pyridin-2-amine (CAS 916979-10-7) is a chemical compound with the molecular formula C6H8N2 and a molecular weight of 114.18 g/mol. IUPAC name: 3,4,6-trideuterio-5-(trideuteriomethyl)pyridin-2-amine. InChIKey: CMBSSVKZOPZBKW-RLTMCGQMSA-N.
| Molecular formula | C6H8N2 |
|---|---|
| Molecular weight | 114.18 g/mol |
| IUPAC name | 3,4,6-trideuterio-5-(trideuteriomethyl)pyridin-2-amine |
| InChIKey | CMBSSVKZOPZBKW-RLTMCGQMSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1C([2H])([2H])[2H])[2H])N)[2H] |
Computed by PubChem (NCBI)