Products 917095-86-4
CAS 917095-86-4 is the registry number for BVT-74316. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(2-methoxy-5-methylphenyl)-7-piperidin-4-yloxy-1-benzofuran-5-sulfonamide (CAS 917095-86-4) is a chemical compound with the molecular formula C21H24N2O5S and a molecular weight of 416.5 g/mol. IUPAC name: N-(2-methoxy-5-methylphenyl)-7-piperidin-4-yloxy-1-benzofuran-5-sulfonamide. InChIKey: UPQJYTNALAIZCC-UHFFFAOYSA-N.
| Molecular formula | C21H24N2O5S |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | N-(2-methoxy-5-methylphenyl)-7-piperidin-4-yloxy-1-benzofuran-5-sulfonamide |
| InChIKey | UPQJYTNALAIZCC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)NS(=O)(=O)C2=CC(=C3C(=C2)C=CO3)OC4CCNCC4 |
Computed by PubChem (NCBI)