CAS 91713-90-5 appears in our catalog under these names: Bromfenac Impurity 19, Bromfenac Impurity 34, Bromfenac sodium imp-B. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg.
7-(4-bromobenzoyl)-3-methylsulfanyl-1,3-dihydroindol-2-one (CAS 91713-90-5) is a chemical compound with the molecular formula C16H12BrNO2S and a molecular weight of 362.2 g/mol. IUPAC name: 7-(4-bromobenzoyl)-3-methylsulfanyl-1,3-dihydroindol-2-one. InChIKey: NTRVSAGGUDUCFD-UHFFFAOYSA-N.
| Molecular formula | C16H12BrNO2S |
|---|---|
| Molecular weight | 362.2 g/mol |
| IUPAC name | 7-(4-bromobenzoyl)-3-methylsulfanyl-1,3-dihydroindol-2-one |
| InChIKey | NTRVSAGGUDUCFD-UHFFFAOYSA-N |
| SMILES | CSC1C2=C(C(=CC=C2)C(=O)C3=CC=C(C=C3)Br)NC1=O |
Computed by PubChem (NCBI)