CAS 91724-67-3 appears in our catalog under these names: Sodium 3-bromobenzenesulfonate, sodium 3-bromobenzene-1-sulfonate, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 100mg, 250mg.
Sodium 3-bromobenzenesulfonate (CAS 91724-67-3) is a chemical compound with the molecular formula C6H4BrNaO3S and a molecular weight of 259.05 g/mol. IUPAC name: sodium 3-bromobenzenesulfonate. InChIKey: IKVCBLQTUAXKFQ-UHFFFAOYSA-M.
| Molecular formula | C6H4BrNaO3S |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | sodium 3-bromobenzenesulfonate |
| InChIKey | IKVCBLQTUAXKFQ-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC(=C1)Br)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)