CAS 917562-22-2 is the registry number for Dimethyl 2-(4-(methylsulfonyl)-2-nitrophenyl)malonate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
Dimethyl 2-(4-methylsulfonyl-2-nitrophenyl)propanedioate (CAS 917562-22-2) is a chemical compound with the molecular formula C12H13NO8S and a molecular weight of 331.30 g/mol. IUPAC name: dimethyl 2-(4-methylsulfonyl-2-nitrophenyl)propanedioate. InChIKey: COOGCONCEDRXES-UHFFFAOYSA-N.
| Molecular formula | C12H13NO8S |
|---|---|
| Molecular weight | 331.30 g/mol |
| IUPAC name | dimethyl 2-(4-methylsulfonyl-2-nitrophenyl)propanedioate |
| InChIKey | COOGCONCEDRXES-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=C(C=C1)S(=O)(=O)C)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)