CAS 91774-25-3 is the registry number for (2-(Trimethylammonium)ethyl)methanethiosulfonate Bromide. Offered by: TRC. Available pack sizes: 2,5g, 250mg.
Trimethyl(2-methylsulfonylsulfanylethyl)azanium bromide (CAS 91774-25-3) is a chemical compound with the molecular formula C6H16BrNO2S2 and a molecular weight of 278.2 g/mol. IUPAC name: trimethyl(2-methylsulfonylsulfanylethyl)azanium bromide. InChIKey: DZWJBKUVHJSHAR-UHFFFAOYSA-M.
| Molecular formula | C6H16BrNO2S2 |
|---|---|
| Molecular weight | 278.2 g/mol |
| IUPAC name | trimethyl(2-methylsulfonylsulfanylethyl)azanium bromide |
| InChIKey | DZWJBKUVHJSHAR-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCSS(=O)(=O)C.[Br-] |
Computed by PubChem (NCBI)