Products 917746-30-6
CAS 917746-30-6 is the registry number for 3-Ethyl-6,7-dimethyl-quinoline-2-thiol. Offered by: Fluorochem. Available pack sizes: 1g.
3-ethyl-6,7-dimethyl-1H-quinoline-2-thione (CAS 917746-30-6) is a chemical compound with the molecular formula C13H15NS and a molecular weight of 217.33 g/mol. IUPAC name: 3-ethyl-6,7-dimethyl-1H-quinoline-2-thione. InChIKey: GEVPWCXJEDWXAY-UHFFFAOYSA-N.
| Molecular formula | C13H15NS |
|---|---|
| Molecular weight | 217.33 g/mol |
| IUPAC name | 3-ethyl-6,7-dimethyl-1H-quinoline-2-thione |
| InChIKey | GEVPWCXJEDWXAY-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C(C(=C2)C)C)NC1=S |
Computed by PubChem (NCBI)