Products 917885-01-9
CAS 917885-01-9 appears in our catalog under these names: 5-Fluoro-6-hydroxy-2,3-dihydro-1H-inden-1-one, 95%, 5-Fluoro-6-hydroxy-2,3-dihydro-1H-inden-1-one, 97%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 100mg.
5-fluoro-6-hydroxy-2,3-dihydroinden-1-one (CAS 917885-01-9) is a chemical compound with the molecular formula C9H7FO2 and a molecular weight of 166.15 g/mol. IUPAC name: 5-fluoro-6-hydroxy-2,3-dihydroinden-1-one. InChIKey: YRHPPGLYOYCXOT-UHFFFAOYSA-N.
| Molecular formula | C9H7FO2 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | 5-fluoro-6-hydroxy-2,3-dihydroinden-1-one |
| InChIKey | YRHPPGLYOYCXOT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=CC(=C(C=C21)F)O |
Computed by PubChem (NCBI)