CAS 917891-35-1 appears in our catalog under these names: LGD-3303, LGD 3303, >95% (HPLC), LGD–3303, LGD 3303, LGD 3303, min. 95 %, 10 mg. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Roth. Available pack sizes: on request, 1mg, 2,5mg, 5mg, 10mg, 100mg, 10mM (in 1ml dmso), 25mg.
9-chloro-2-ethyl-1-methyl-3-(2,2,2-trifluoroethyl)-6H-pyrrolo[3,2-f]quinolin-7-one (CAS 917891-35-1) is a chemical compound with the molecular formula C16H14ClF3N2O and a molecular weight of 342.74 g/mol. IUPAC name: 9-chloro-2-ethyl-1-methyl-3-(2,2,2-trifluoroethyl)-6H-pyrrolo[3,2-f]quinolin-7-one. InChIKey: OMXGOGXEWUCLFI-UHFFFAOYSA-N.
| Molecular formula | C16H14ClF3N2O |
|---|---|
| Molecular weight | 342.74 g/mol |
| IUPAC name | 9-chloro-2-ethyl-1-methyl-3-(2,2,2-trifluoroethyl)-6H-pyrrolo[3,2-f]quinolin-7-one |
| InChIKey | OMXGOGXEWUCLFI-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(N1CC(F)(F)F)C=CC3=C2C(=CC(=O)N3)Cl)C |
Computed by PubChem (NCBI)