Products 917917-50-1
CAS 917917-50-1 is the registry number for tert-Butyl 4-(6-chloro-2-oxoindolin-3-yl)piperidine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)piperidine-1-carboxylate (CAS 917917-50-1) is a chemical compound with the molecular formula C18H23ClN2O3 and a molecular weight of 350.8 g/mol. IUPAC name: tert-butyl 4-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)piperidine-1-carboxylate. InChIKey: RVPGKDKRCNKKRF-UHFFFAOYSA-N.
| Molecular formula | C18H23ClN2O3 |
|---|---|
| Molecular weight | 350.8 g/mol |
| IUPAC name | tert-butyl 4-(6-chloro-2-oxo-1,3-dihydroindol-3-yl)piperidine-1-carboxylate |
| InChIKey | RVPGKDKRCNKKRF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2C3=C(C=C(C=C3)Cl)NC2=O |
Computed by PubChem (NCBI)