CAS 917918-81-1 appears in our catalog under these names: 5-Bromo-4-[2-(dimethylamino)ethenyl]-2-methoxy-3-nitropyridine, 95%, 95%, Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl-, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(E)-2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine (CAS 917918-81-1) is a chemical compound with the molecular formula C10H12BrN3O3 and a molecular weight of 302.12 g/mol. IUPAC name: (E)-2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine. InChIKey: BNKMXMCVPWPRMR-SNAWJCMRSA-N.
| Molecular formula | C10H12BrN3O3 |
|---|---|
| Molecular weight | 302.12 g/mol |
| IUPAC name | (E)-2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethylethenamine |
| InChIKey | BNKMXMCVPWPRMR-SNAWJCMRSA-N |
| SMILES | CN(C)/C=C/C1=C(C(=NC=C1Br)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)