Products 917925-73-6

CAS 917925-73-6 is the registry number for Pyridine-3-carboxamide hydrate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.

Structural formula: {0} (CAS {1})

Pyridine-3-carboxamide;hydrate (CAS 917925-73-6) is a chemical compound with the molecular formula C6H8N2O2 and a molecular weight of 140.14 g/mol. IUPAC name: pyridine-3-carboxamide;hydrate. InChIKey: JYGBLFUCVAWHNM-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8N2O2
Molecular weight140.14 g/mol
IUPAC namepyridine-3-carboxamide;hydrate
InChIKeyJYGBLFUCVAWHNM-UHFFFAOYSA-N
SMILESC1=CC(=CN=C1)C(=O)N.O

Computed by PubChem (NCBI)