CAS 918490-51-4 appears in our catalog under these names: 7-Chloro-6-fluoroisoquinoline, 95+%, 7-Chloro-6-fluoroisoquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
7-chloro-6-fluoroisoquinoline (CAS 918490-51-4) is a chemical compound with the molecular formula C9H5ClFN and a molecular weight of 181.59 g/mol. IUPAC name: 7-chloro-6-fluoroisoquinoline. InChIKey: BCZPUVXMWIBIRE-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFN |
|---|---|
| Molecular weight | 181.59 g/mol |
| IUPAC name | 7-chloro-6-fluoroisoquinoline |
| InChIKey | BCZPUVXMWIBIRE-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=CC(=C(C=C21)F)Cl |
Computed by PubChem (NCBI)