CAS 918518-79-3 appears in our catalog under these names: 3-Benzyl-5-bromo-2-chloroquinoline, 98%, 3-Benzyl-5-bromo-2-chloroquinoline, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 250mg, 100mg.
3-benzyl-5-bromo-2-chloroquinoline (CAS 918518-79-3) is a chemical compound with the molecular formula C16H11BrClN and a molecular weight of 332.62 g/mol. IUPAC name: 3-benzyl-5-bromo-2-chloroquinoline. InChIKey: MMSMFFGPBNXOKG-UHFFFAOYSA-N.
| Molecular formula | C16H11BrClN |
|---|---|
| Molecular weight | 332.62 g/mol |
| IUPAC name | 3-benzyl-5-bromo-2-chloroquinoline |
| InChIKey | MMSMFFGPBNXOKG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC3=C(C=CC=C3Br)N=C2Cl |
Computed by PubChem (NCBI)