CAS 918523-98-5 is the registry number for 1-Bromo-4-[[(1,1-dimethylethyl)dimethylsilyl]oxy]-2,5-difluorobenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
(4-bromo-2,5-difluorophenoxy)-tert-butyl-dimethylsilane (CAS 918523-98-5) is a chemical compound with the molecular formula C12H17BrF2OSi and a molecular weight of 323.25 g/mol. IUPAC name: (4-bromo-2,5-difluorophenoxy)-tert-butyl-dimethylsilane. InChIKey: UXMAOOWTOSULIG-UHFFFAOYSA-N.
| Molecular formula | C12H17BrF2OSi |
|---|---|
| Molecular weight | 323.25 g/mol |
| IUPAC name | (4-bromo-2,5-difluorophenoxy)-tert-butyl-dimethylsilane |
| InChIKey | UXMAOOWTOSULIG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC(=C(C=C1F)Br)F |
Computed by PubChem (NCBI)