Products 918524-58-0

CAS 918524-58-0 is the registry number for 2-Fluoro-5-(propylsulfonamido)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-fluoro-5-(propylsulfonylamino)benzoic acid (CAS 918524-58-0) is a chemical compound with the molecular formula C10H12FNO4S and a molecular weight of 261.27 g/mol. IUPAC name: 2-fluoro-5-(propylsulfonylamino)benzoic acid. InChIKey: IRDDYXPNKUGCHF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12FNO4S
Molecular weight261.27 g/mol
IUPAC name2-fluoro-5-(propylsulfonylamino)benzoic acid
InChIKeyIRDDYXPNKUGCHF-UHFFFAOYSA-N
SMILESCCCS(=O)(=O)NC1=CC(=C(C=C1)F)C(=O)O

Computed by PubChem (NCBI)