CAS 918659-10-6 appears in our catalog under these names: Dehydro Azelnidipine, Dehydro Azelnidipine, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
3-O-(1-benzhydrylazetidin-3-yl) 5-O-propan-2-yl 2-amino-6-methyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate (CAS 918659-10-6) is a chemical compound with the molecular formula C33H32N4O6 and a molecular weight of 580.6 g/mol. IUPAC name: 3-O-(1-benzhydrylazetidin-3-yl) 5-O-propan-2-yl 2-amino-6-methyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate. InChIKey: FWRXOJGNMIWOGZ-UHFFFAOYSA-N.
| Molecular formula | C33H32N4O6 |
|---|---|
| Molecular weight | 580.6 g/mol |
| IUPAC name | 3-O-(1-benzhydrylazetidin-3-yl) 5-O-propan-2-yl 2-amino-6-methyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate |
| InChIKey | FWRXOJGNMIWOGZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)N)C(=O)OC2CN(C2)C(C3=CC=CC=C3)C4=CC=CC=C4)C5=CC(=CC=C5)[N+](=O)[O-])C(=O)OC(C)C |
Computed by PubChem (NCBI)