CAS 918778-54-8 is the registry number for 1,3,2-Dioxaborolane, 2-(4'-butyl[1,1'-biphenyl]-4-yl)-4,4,5,5-tetramethyl-, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
2-[4-(4-butylphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 918778-54-8) is a chemical compound with the molecular formula C22H29BO2 and a molecular weight of 336.3 g/mol. IUPAC name: 2-[4-(4-butylphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GIKHJFYANYHXMX-UHFFFAOYSA-N.
| Molecular formula | C22H29BO2 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | 2-[4-(4-butylphenyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GIKHJFYANYHXMX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CC=C(C=C3)CCCC |
Computed by PubChem (NCBI)