CAS 91878-52-3 is the registry number for (R)-Celiprolol. Offered by: Chemat Brand. Available pack sizes: on request.
3-[3-acetyl-4-[(2R)-3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-1,1-diethylurea (CAS 91878-52-3) is a chemical compound with the molecular formula C20H33N3O4 and a molecular weight of 379.5 g/mol. IUPAC name: 3-[3-acetyl-4-[(2R)-3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-1,1-diethylurea. InChIKey: JOATXPAWOHTVSZ-MRXNPFEDSA-N.
| Molecular formula | C20H33N3O4 |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | 3-[3-acetyl-4-[(2R)-3-(tert-butylamino)-2-hydroxypropoxy]phenyl]-1,1-diethylurea |
| InChIKey | JOATXPAWOHTVSZ-MRXNPFEDSA-N |
| SMILES | CCN(CC)C(=O)NC1=CC(=C(C=C1)OC[C@@H](CNC(C)(C)C)O)C(=O)C |
Computed by PubChem (NCBI)