CAS 919039-45-5 is the registry number for 1-(2-Methyl-2,3-dihydrobenzofuran-5-yl)propan-1-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-amine (CAS 919039-45-5) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: 1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-amine. InChIKey: ZZHKIYFEXZSVMA-UHFFFAOYSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | 1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)propan-1-amine |
| InChIKey | ZZHKIYFEXZSVMA-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC2=C(C=C1)OC(C2)C)N |
Computed by PubChem (NCBI)