CAS 919081-42-8 appears in our catalog under these names: Tedizolid Impurity 55, (5S)-3-(3-Fluorophenyl)-5-(hydroxymethyl)-2-pxazolidinone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
(5S)-3-(3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one (CAS 919081-42-8) is a chemical compound with the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. IUPAC name: (5S)-3-(3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one. InChIKey: XYUGDJIYKLSISX-VIFPVBQESA-N.
| Molecular formula | C10H10FNO3 |
|---|---|
| Molecular weight | 211.19 g/mol |
| IUPAC name | (5S)-3-(3-fluorophenyl)-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| InChIKey | XYUGDJIYKLSISX-VIFPVBQESA-N |
| SMILES | C1[C@H](OC(=O)N1C2=CC(=CC=C2)F)CO |
Computed by PubChem (NCBI)