CAS 919091-63-7 appears in our catalog under these names: Ra-9, 95%, RA–9, RA-9/ 99.31% (existing batch purity), Ra-9 ups inhibitor, RA-9 98%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 10mg, 10mM (in 1ml dmso), 5mg, 50mg, 25mg.
(3E,5E)-3,5-bis[(4-nitrophenyl)methylidene]piperidin-4-one (CAS 919091-63-7) is a chemical compound with the molecular formula C19H15N3O5 and a molecular weight of 365.3 g/mol. IUPAC name: (3E,5E)-3,5-bis[(4-nitrophenyl)methylidene]piperidin-4-one. InChIKey: YUYPWAMLWZVHAE-KAVGSWPWSA-N.
| Molecular formula | C19H15N3O5 |
|---|---|
| Molecular weight | 365.3 g/mol |
| IUPAC name | (3E,5E)-3,5-bis[(4-nitrophenyl)methylidene]piperidin-4-one |
| InChIKey | YUYPWAMLWZVHAE-KAVGSWPWSA-N |
| SMILES | C\1NC/C(=C\C2=CC=C(C=C2)[N+](=O)[O-])/C(=O)/C1=C/C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)