Products 919352-63-9
CAS 919352-63-9 is the registry number for L-Leucine, N-[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]-, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-[[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-4-methylpentanoic acid (CAS 919352-63-9) is a chemical compound with the molecular formula C14H17BrF3NO2 and a molecular weight of 368.19 g/mol. IUPAC name: (2S)-2-[[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-4-methylpentanoic acid. InChIKey: HFQAABRSEQRKGS-RYUDHWBXSA-N.
| Molecular formula | C14H17BrF3NO2 |
|---|---|
| Molecular weight | 368.19 g/mol |
| IUPAC name | (2S)-2-[[(1S)-1-(4-bromophenyl)-2,2,2-trifluoroethyl]amino]-4-methylpentanoic acid |
| InChIKey | HFQAABRSEQRKGS-RYUDHWBXSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)N[C@@H](C1=CC=C(C=C1)Br)C(F)(F)F |
Computed by PubChem (NCBI)