CAS 91949-94-9 appears in our catalog under these names: 2-Benzofuranethanamine Hydrochloride, 2-(1-Benzofuran-2-yl)ethan-1-amine hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 50mg, 0,5g.
2-(1-benzofuran-2-yl)ethanamine;hydrochloride (CAS 91949-94-9) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 2-(1-benzofuran-2-yl)ethanamine;hydrochloride. InChIKey: NUQMDSSVJGDKDB-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 2-(1-benzofuran-2-yl)ethanamine;hydrochloride |
| InChIKey | NUQMDSSVJGDKDB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(O2)CCN.Cl |
Computed by PubChem (NCBI)