CAS 919514-01-5 appears in our catalog under these names: Duloxetine-d7, >95% (HPLC), Duloxetine–d7, Duloxetine-d7, 97.32%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
(3S)-3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)oxy-N-methyl-3-thiophen-2-ylpropan-1-amine (CAS 919514-01-5) is a chemical compound with the molecular formula C18H19NOS and a molecular weight of 304.5 g/mol. IUPAC name: (3S)-3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)oxy-N-methyl-3-thiophen-2-ylpropan-1-amine. InChIKey: ZEUITGRIYCTCEM-KGAVXYHHSA-N.
| Molecular formula | C18H19NOS |
|---|---|
| Molecular weight | 304.5 g/mol |
| IUPAC name | (3S)-3-(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)oxy-N-methyl-3-thiophen-2-ylpropan-1-amine |
| InChIKey | ZEUITGRIYCTCEM-KGAVXYHHSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2O[C@@H](CCNC)C3=CC=CS3)[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)