CAS 919522-32-0 is the registry number for 6-Chloro-N-(4-chlorobenzyl)pyridazin-3-amine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-N-[(4-chlorophenyl)methyl]pyridazin-3-amine (CAS 919522-32-0) is a chemical compound with the molecular formula C11H9Cl2N3 and a molecular weight of 254.11 g/mol. IUPAC name: 6-chloro-N-[(4-chlorophenyl)methyl]pyridazin-3-amine. InChIKey: DXJXGSUJLPHYLE-UHFFFAOYSA-N.
| Molecular formula | C11H9Cl2N3 |
|---|---|
| Molecular weight | 254.11 g/mol |
| IUPAC name | 6-chloro-N-[(4-chlorophenyl)methyl]pyridazin-3-amine |
| InChIKey | DXJXGSUJLPHYLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC2=NN=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)