CAS 92-55-7 appears in our catalog under these names: 5-Nitro-2-furaldehyde diacetate, 97%, Nifuroxazide EP Impurity B, Nifuratel Impurity 38 (Nitrofurfural Diacetate), 5-Nitrofuraldehyde Diacetate, >95% (HPLC), (5-Nitrofuran-2-yl)methylene Diacetate. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 5g, 500g, 1kg, 100g, 25g, on request, 100mg, 1g.
[acetyloxy-(5-nitrofuran-2-yl)methyl] acetate (CAS 92-55-7) is a chemical compound with the molecular formula C9H9NO7 and a molecular weight of 243.17 g/mol. IUPAC name: [acetyloxy-(5-nitrofuran-2-yl)methyl] acetate. InChIKey: HSXKWKJCZNRMJO-UHFFFAOYSA-N.
| Molecular formula | C9H9NO7 |
|---|---|
| Molecular weight | 243.17 g/mol |
| IUPAC name | [acetyloxy-(5-nitrofuran-2-yl)methyl] acetate |
| InChIKey | HSXKWKJCZNRMJO-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C1=CC=C(O1)[N+](=O)[O-])OC(=O)C |
Computed by PubChem (NCBI)