CAS 920-68-3 appears in our catalog under these names: methylbis(trimethylsilyl)amine, 96%, Heptamethyldisilazane, Heptamethyldisilazane, >96.0%(GC), N,1,1,1-Tetramethyl-N-(trimethylsilyl)silanamine 98+%, Heptamethyldisilazane, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 5g, 10g, 1g, 100ml, 25ml, 25g, 100g, 500g.
N,N-bis(trimethylsilyl)methanamine (CAS 920-68-3) is a chemical compound with the molecular formula C7H21NSi2 and a molecular weight of 175.42 g/mol. IUPAC name: N,N-bis(trimethylsilyl)methanamine. InChIKey: ZSMNRKGGHXLZEC-UHFFFAOYSA-N.
| Molecular formula | C7H21NSi2 |
|---|---|
| Molecular weight | 175.42 g/mol |
| IUPAC name | N,N-bis(trimethylsilyl)methanamine |
| InChIKey | ZSMNRKGGHXLZEC-UHFFFAOYSA-N |
| SMILES | CN([Si](C)(C)C)[Si](C)(C)C |
Computed by PubChem (NCBI)