Products 920-88-7

CAS 920-88-7 appears in our catalog under these names: Heptane-4-sulfonyl chloride, 95%, Heptane-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.

Heptane-4-sulfonyl chloride (CAS 920-88-7) is a chemical compound with the molecular formula C7H15ClO2S and a molecular weight of 198.71 g/mol. IUPAC name: heptane-4-sulfonyl chloride. InChIKey: OWMJFQIHJFOWPP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H15ClO2S
Molecular weight198.71 g/mol
IUPAC nameheptane-4-sulfonyl chloride
InChIKeyOWMJFQIHJFOWPP-UHFFFAOYSA-N
SMILESCCCC(CCC)S(=O)(=O)Cl

Computed by PubChem (NCBI)