CAS 920023-48-9 appears in our catalog under these names: 5-Bromo-1'-methylspiro[indoline-3,4'-piperidin]-2-one, 95%, 95%, 5-Bromo-1'-methylspiro[indoline-3,4'-piperidin]-2-one, 95+%, 5-Bromo-1'-methylspiro[indoline-3,4'-piperidin]-2-one, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
5-bromo-1'-methylspiro[1H-indole-3,4'-piperidine]-2-one (CAS 920023-48-9) is a chemical compound with the molecular formula C13H15BrN2O and a molecular weight of 295.17 g/mol. IUPAC name: 5-bromo-1'-methylspiro[1H-indole-3,4'-piperidine]-2-one. InChIKey: RPTDNCLENFDGQW-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN2O |
|---|---|
| Molecular weight | 295.17 g/mol |
| IUPAC name | 5-bromo-1'-methylspiro[1H-indole-3,4'-piperidine]-2-one |
| InChIKey | RPTDNCLENFDGQW-UHFFFAOYSA-N |
| SMILES | CN1CCC2(CC1)C3=C(C=CC(=C3)Br)NC2=O |
Computed by PubChem (NCBI)