Products 920459-41-2
CAS 920459-41-2 is the registry number for DprE1-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl N-[2-[(4-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiophene-3-carbonyl]carbamate (CAS 920459-41-2) is a chemical compound with the molecular formula C19H21N3O6S2 and a molecular weight of 451.5 g/mol. IUPAC name: ethyl N-[2-[(4-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiophene-3-carbonyl]carbamate. InChIKey: FFUVSZKOCCMGPX-UHFFFAOYSA-N.
| Molecular formula | C19H21N3O6S2 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | ethyl N-[2-[(4-pyrrolidin-1-ylsulfonylbenzoyl)amino]thiophene-3-carbonyl]carbamate |
| InChIKey | FFUVSZKOCCMGPX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC(=O)C1=C(SC=C1)NC(=O)C2=CC=C(C=C2)S(=O)(=O)N3CCCC3 |
Computed by PubChem (NCBI)