CAS 92057-29-9 appears in our catalog under these names: 2-(3-Nitrophenyl)thiazole-4-carbaldehyde, 95+%, 2-(3-Nitrophenyl)-1,3-thiazole-4-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(3-nitrophenyl)-1,3-thiazole-4-carbaldehyde (CAS 92057-29-9) is a chemical compound with the molecular formula C10H6N2O3S and a molecular weight of 234.23 g/mol. IUPAC name: 2-(3-nitrophenyl)-1,3-thiazole-4-carbaldehyde. InChIKey: JAIHSHSJTRWSNB-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O3S |
|---|---|
| Molecular weight | 234.23 g/mol |
| IUPAC name | 2-(3-nitrophenyl)-1,3-thiazole-4-carbaldehyde |
| InChIKey | JAIHSHSJTRWSNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NC(=CS2)C=O |
Computed by PubChem (NCBI)