CAS 920915-26-0 is the registry number for ZNU-IMB-Z15, 99.03%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 10 mg, 50 mg.
4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide (CAS 920915-26-0) is a chemical compound with the molecular formula C20H17N3O3S2 and a molecular weight of 411.5 g/mol. IUPAC name: 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide. InChIKey: ZBSYDTSUARCOGR-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O3S2 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | 4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide |
| InChIKey | ZBSYDTSUARCOGR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)COC2=CC=C(C=C2)C(=O)NC3=NC(=CS3)C4=CC=CS4 |
Computed by PubChem (NCBI)