Products 92117-94-7
CAS 92117-94-7 appears in our catalog under these names: 4'-Methoxypuerarin/ 98.74% (existing batch purity), 4'-Methoxypuerarin, 99.44% ,, 99.44% ,, 4'-Methoxypuerarin, 99.70%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 10 mg, 1 mg, 5 mg.
7-hydroxy-3-(4-methoxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one (CAS 92117-94-7) is a chemical compound with the molecular formula C22H22O9 and a molecular weight of 430.4 g/mol. IUPAC name: 7-hydroxy-3-(4-methoxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one. InChIKey: UWRLUNPRLSNXRR-PGPONNFDSA-N.
| Molecular formula | C22H22O9 |
|---|---|
| Molecular weight | 430.4 g/mol |
| IUPAC name | 7-hydroxy-3-(4-methoxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
| InChIKey | UWRLUNPRLSNXRR-PGPONNFDSA-N |
| SMILES | COC1=CC=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
Computed by PubChem (NCBI)