CAS 92134-98-0 appears in our catalog under these names: Fosphenytoin disodium 98%, Fosphenytoin Disodium Salt, Fosphenytoin disodium/ 99.91% (existing batch purity), Fosphenytoin (disodium) (Standard), Fosphenytoin (disodium), 99.81%. Offered by: Ambeed, Chemat Brand, TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, on request, 25mg.
Disodium;(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl phosphate (CAS 92134-98-0) is a chemical compound with the molecular formula C16H13N2Na2O6P and a molecular weight of 406.24 g/mol. IUPAC name: disodium;(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl phosphate. InChIKey: GQPXYJNXTAFDLT-UHFFFAOYSA-L.
| Molecular formula | C16H13N2Na2O6P |
|---|---|
| Molecular weight | 406.24 g/mol |
| IUPAC name | disodium;(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl phosphate |
| InChIKey | GQPXYJNXTAFDLT-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)C2(C(=O)N(C(=O)N2)COP(=O)([O-])[O-])C3=CC=CC=C3.[Na+].[Na+] |
Computed by PubChem (NCBI)