CAS 92151-30-9 is the registry number for Levothyroxine Impurity 31. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenyl]acetic acid (CAS 92151-30-9) is a chemical compound with the molecular formula C14H9I3O4 and a molecular weight of 621.93 g/mol. IUPAC name: 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenyl]acetic acid. InChIKey: XLWNVHQIKWRWOE-UHFFFAOYSA-N.
| Molecular formula | C14H9I3O4 |
|---|---|
| Molecular weight | 621.93 g/mol |
| IUPAC name | 2-[4-(4-hydroxy-3,5-diiodophenoxy)-3-iodophenyl]acetic acid |
| InChIKey | XLWNVHQIKWRWOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)I)OC2=CC(=C(C(=C2)I)O)I |
Computed by PubChem (NCBI)