Products 921599-70-4

CAS 921599-70-4 appears in our catalog under these names: 2,2-difluorocyclopentan-1-amine hydrochloride, 2,2-Difluorocyclopentan-1-amine hydrochloride 95%, Cyclopentanamine,2,2-difluoro-,hydrochloride(1:1), 95%, 95%, 2,2-Difluorocyclopentan-1-amine hydrochloride, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2,2-difluorocyclopentan-1-amine;hydrochloride (CAS 921599-70-4) is a chemical compound with the molecular formula C5H10ClF2N and a molecular weight of 157.59 g/mol. IUPAC name: 2,2-difluorocyclopentan-1-amine;hydrochloride. InChIKey: NKKPWPHIGLLMRF-UHFFFAOYSA-N.

Identity
Molecular formulaC5H10ClF2N
Molecular weight157.59 g/mol
IUPAC name2,2-difluorocyclopentan-1-amine;hydrochloride
InChIKeyNKKPWPHIGLLMRF-UHFFFAOYSA-N
SMILESC1CC(C(C1)(F)F)N.Cl

Computed by PubChem (NCBI)