CAS 921602-80-4 is the registry number for (1R,2R)-rel-2-Fluorocyclopentan-1-amine Hydrobromide. Offered by: TRC. Available pack sizes: 750mg.
Trans-(1R,2R)-2-fluorocyclopentan-1-amine;hydrobromide (CAS 921602-80-4) is a chemical compound with the molecular formula C5H11BrFN and a molecular weight of 184.05 g/mol. IUPAC name: trans-(1R,2R)-2-fluorocyclopentan-1-amine;hydrobromide. InChIKey: UIDCAUPAKFUCGM-TYSVMGFPSA-N.
| Molecular formula | C5H11BrFN |
|---|---|
| Molecular weight | 184.05 g/mol |
| IUPAC name | trans-(1R,2R)-2-fluorocyclopentan-1-amine;hydrobromide |
| InChIKey | UIDCAUPAKFUCGM-TYSVMGFPSA-N |
| SMILES | C1C[C@H]([C@@H](C1)F)N.Br |
Computed by PubChem (NCBI)