Products 921927-91-5
CAS 921927-91-5 is the registry number for Methyl 2-((1R,3R)-3-amino-1-hydroxy-4-methylpentyl)thiazole-4-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(1R,3R)-3-amino-1-hydroxy-4-methylpentyl]-1,3-thiazole-4-carboxylate;hydrochloride (CAS 921927-91-5) is a chemical compound with the molecular formula C11H19ClN2O3S and a molecular weight of 294.80 g/mol. IUPAC name: methyl 2-[(1R,3R)-3-amino-1-hydroxy-4-methylpentyl]-1,3-thiazole-4-carboxylate;hydrochloride. InChIKey: ZTDMONQBCYZLQK-PRCZDLBKSA-N.
| Molecular formula | C11H19ClN2O3S |
|---|---|
| Molecular weight | 294.80 g/mol |
| IUPAC name | methyl 2-[(1R,3R)-3-amino-1-hydroxy-4-methylpentyl]-1,3-thiazole-4-carboxylate;hydrochloride |
| InChIKey | ZTDMONQBCYZLQK-PRCZDLBKSA-N |
| SMILES | CC(C)[C@@H](C[C@H](C1=NC(=CS1)C(=O)OC)O)N.Cl |
Computed by PubChem (NCBI)