Products 1840147-44-5
CAS 1840147-44-5 is the registry number for 4-Methoxy-N-methyl-N-(2-(methylamino)ethyl)benzenesulfonamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methoxy-N-methyl-N-[2-(methylamino)ethyl]benzenesulfonamide;hydrochloride (CAS 1840147-44-5) is a chemical compound with the molecular formula C11H19ClN2O3S and a molecular weight of 294.80 g/mol. IUPAC name: 4-methoxy-N-methyl-N-[2-(methylamino)ethyl]benzenesulfonamide;hydrochloride. InChIKey: KEWADPPRSRVETR-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN2O3S |
|---|---|
| Molecular weight | 294.80 g/mol |
| IUPAC name | 4-methoxy-N-methyl-N-[2-(methylamino)ethyl]benzenesulfonamide;hydrochloride |
| InChIKey | KEWADPPRSRVETR-UHFFFAOYSA-N |
| SMILES | CNCCN(C)S(=O)(=O)C1=CC=C(C=C1)OC.Cl |
Computed by PubChem (NCBI)