CAS 922-32-7 appears in our catalog under these names: Phosphocreatine disodium/ 95.32% (existing batch purity), Phosphocreatine disodium salt, Creatine phosphate disodium salt hydrate, 98.00%, Sodium Creatine Phosphate, >98.0%(HPLC), Phosphocreatine disodium 98+%. Offered by: TargetMol, GLPBio, Chemat, TCI, Ambeed. Available pack sizes: 100mg, 200mg, 500mg, 10mM (in 1ml water), 100g, 25g, 5g, 1g.
Disodium;2-[methyl-(N'-phosphonatocarbamimidoyl)amino]acetic acid (CAS 922-32-7) is a chemical compound with the molecular formula C4H8N3Na2O5P and a molecular weight of 255.08 g/mol. IUPAC name: disodium;2-[methyl-(N'-phosphonatocarbamimidoyl)amino]acetic acid. InChIKey: RNTXMYSPASRLFT-UHFFFAOYSA-L.
| Molecular formula | C4H8N3Na2O5P |
|---|---|
| Molecular weight | 255.08 g/mol |
| IUPAC name | disodium;2-[methyl-(N'-phosphonatocarbamimidoyl)amino]acetic acid |
| InChIKey | RNTXMYSPASRLFT-UHFFFAOYSA-L |
| SMILES | CN(CC(=O)O)C(=NP(=O)([O-])[O-])N.[Na+].[Na+] |
Computed by PubChem (NCBI)