Products 92204-03-0
CAS 92204-03-0 appears in our catalog under these names: Cyclooctane-d16, Cyclooctane-d16, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 10mg, 50mg, 1g, 0,5g.
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecadeuteriocyclooctane (CAS 92204-03-0) is a chemical compound with the molecular formula C8H16 and a molecular weight of 128.31 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecadeuteriocyclooctane. InChIKey: WJTCGQSWYFHTAC-SADLKCKLSA-N.
| Molecular formula | C8H16 |
|---|---|
| Molecular weight | 128.31 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecadeuteriocyclooctane |
| InChIKey | WJTCGQSWYFHTAC-SADLKCKLSA-N |
| SMILES | [2H]C1(C(C(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)